C25H34N2O6S2 — CID 4073664
bis(2-propan-2-ylsulfanylethyl) 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 4073664) has the molecular formula C25H34N2O6S2 and a molecular weight of 522.69 g/mol. Its IUPAC name is bis(2-propan-2-ylsulfanylethyl) 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | bis(2-propan-2-ylsulfanylethyl) 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 4073664 |
| Molecular Formula | C25H34N2O6S2 |
| Molecular Weight | 522.69 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | bis(2-propan-2-ylsulfanylethyl) 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CC1=C(C(=O)OCCSC(C)C)C(c2cccc([N+](=O)[O-])c2)C(C(=O)OCCSC(C)C)=C(C)N1 |
| InChI | InChI=1S/C25H34N2O6S2/c1-15(2)34-12-10-32-24(28)21-17(5)26-18(6)22(25(29)33-11-13-35-16(3)4)23(21)19-8-7-9-20(14-19)27(30)31/h7-9,14-16,23,26H,10-13H2,1-6H3 |
| InChIKey | ABOBLOURSQFCDM-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.69 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|