C19H21IN2O6 — CID 56932221
3-O-ethyl 5-O-(2-(125I)iodoethyl) 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 56932221) has the molecular formula C19H21IN2O6 and a molecular weight of 498.29 g/mol. Its IUPAC name is 3-O-ethyl 5-O-(2-(125I)iodoethyl) 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-ethyl 5-O-(2-(125I)iodoethyl) 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 56932221 |
| Molecular Formula | C19H21IN2O6 |
| Molecular Weight | 498.29 g/mol |
| Exact Mass | 498.04 |
| IUPAC Name | 3-O-ethyl 5-O-(2-(125I)iodoethyl) 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC[125I])C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H21IN2O6/c1-4-27-18(23)15-11(2)21-12(3)16(19(24)28-9-8-20)17(15)13-6-5-7-14(10-13)22(25)26/h5-7,10,17,21H,4,8-9H2,1-3H3/i20-2 |
| InChIKey | ZBWKRLFPHLXASX-STTHPYEQSA-N |
| XLogP | 3.37 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.29 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|