C25H30N2O8S2 — CID 15078631
bis(3-acetylsulfanylpropyl) 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 15078631) has the molecular formula C25H30N2O8S2 and a molecular weight of 550.66 g/mol. Its IUPAC name is bis(3-acetylsulfanylpropyl) 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | bis(3-acetylsulfanylpropyl) 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 15078631 |
| Molecular Formula | C25H30N2O8S2 |
| Molecular Weight | 550.66 g/mol |
| Exact Mass | 550.14 |
| IUPAC Name | bis(3-acetylsulfanylpropyl) 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CC(=O)SCCCOC(=O)C1=C(C)NC(C)=C(C(=O)OCCCSC(C)=O)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H30N2O8S2/c1-15-21(24(30)34-10-6-12-36-17(3)28)23(19-8-5-9-20(14-19)27(32)33)22(16(2)26-15)25(31)35-11-7-13-37-18(4)29/h5,8-9,14,23,26H,6-7,10-13H2,1-4H3 |
| InChIKey | QBUNGCUUNRYWOL-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 141.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.66 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|