C31H30N2O8 — CID 70413045
bis[2-(4-hydroxyphenyl)ethyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 70413045) has the molecular formula C31H30N2O8 and a molecular weight of 558.59 g/mol. Its IUPAC name is bis[2-(4-hydroxyphenyl)ethyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | bis[2-(4-hydroxyphenyl)ethyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 70413045 |
| Molecular Formula | C31H30N2O8 |
| Molecular Weight | 558.59 g/mol |
| Exact Mass | 558.20 |
| IUPAC Name | bis[2-(4-hydroxyphenyl)ethyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CC1=C(C(=O)OCCc2ccc(O)cc2)C(c2cccc([N+](=O)[O-])c2)C(C(=O)OCCc2ccc(O)cc2)=C(C)N1 |
| InChI | InChI=1S/C31H30N2O8/c1-19-27(30(36)40-16-14-21-6-10-25(34)11-7-21)29(23-4-3-5-24(18-23)33(38)39)28(20(2)32-19)31(37)41-17-15-22-8-12-26(35)13-9-22/h3-13,18,29,32,34-35H,14-17H2,1-2H3 |
| InChIKey | JPBNGIWGBIHCJC-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 148.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.59 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|