C24H23N3O9 — CID 13318041
5-O-benzyl 3-O-(2-nitrooxyethyl) 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 13318041) has the molecular formula C24H23N3O9 and a molecular weight of 497.46 g/mol. Its IUPAC name is 5-O-benzyl 3-O-(2-nitrooxyethyl) 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-benzyl 3-O-(2-nitrooxyethyl) 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 13318041 |
| Molecular Formula | C24H23N3O9 |
| Molecular Weight | 497.46 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | 5-O-benzyl 3-O-(2-nitrooxyethyl) 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CC1=C(C(=O)OCCO[N+](=O)[O-])C(c2cccc([N+](=O)[O-])c2)C(C(=O)OCc2ccccc2)=C(C)N1 |
| InChI | InChI=1S/C24H23N3O9/c1-15-20(23(28)34-11-12-36-27(32)33)22(18-9-6-10-19(13-18)26(30)31)21(16(2)25-15)24(29)35-14-17-7-4-3-5-8-17/h3-10,13,22,25H,11-12,14H2,1-2H3 |
| InChIKey | CNEDYFDWBINCFL-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 160.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.46 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|