C22H29N3O7S2 — CID 70415491
2-methylsulfanylethyl 2,6-dimethyl-4-(3-nitrophenyl)-5-[2-(propan-2-ylsulfamoyl)acetyl]-1,4-dihydropyridine-3-carboxylate (PubChem CID 70415491) has the molecular formula C22H29N3O7S2 and a molecular weight of 511.62 g/mol. Its IUPAC name is 2-methylsulfanylethyl 2,6-dimethyl-4-(3-nitrophenyl)-5-[2-(propan-2-ylsulfamoyl)acetyl]-1,4-dihydropyridine-3-carboxylate.
| Compound Name | 2-methylsulfanylethyl 2,6-dimethyl-4-(3-nitrophenyl)-5-[2-(propan-2-ylsulfamoyl)acetyl]-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 70415491 |
| Molecular Formula | C22H29N3O7S2 |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.14 |
| IUPAC Name | 2-methylsulfanylethyl 2,6-dimethyl-4-(3-nitrophenyl)-5-[2-(propan-2-ylsulfamoyl)acetyl]-1,4-dihydropyridine-3-carboxylate |
| SMILES | CSCCOC(=O)C1=C(C)NC(C)=C(C(=O)CS(=O)(=O)NC(C)C)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H29N3O7S2/c1-13(2)24-34(30,31)12-18(26)19-14(3)23-15(4)20(22(27)32-9-10-33-5)21(19)16-7-6-8-17(11-16)25(28)29/h6-8,11,13,21,23-24H,9-10,12H2,1-5H3 |
| InChIKey | XSQWXUXEAUWBDY-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 144.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|