C16H16BrN3O6 — CID 5249959
2-bromoethyl 2,6-dimethyl-5-nitro-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate (PubChem CID 5249959) has the molecular formula C16H16BrN3O6 and a molecular weight of 426.22 g/mol. Its IUPAC name is 2-bromoethyl 2,6-dimethyl-5-nitro-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate.
| Compound Name | 2-bromoethyl 2,6-dimethyl-5-nitro-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 5249959 |
| Molecular Formula | C16H16BrN3O6 |
| Molecular Weight | 426.22 g/mol |
| Exact Mass | 425.02 |
| IUPAC Name | 2-bromoethyl 2,6-dimethyl-5-nitro-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate |
| SMILES | CC1=C(C(=O)OCCBr)C(c2cccc([N+](=O)[O-])c2)C([N+](=O)[O-])=C(C)N1 |
| InChI | InChI=1S/C16H16BrN3O6/c1-9-13(16(21)26-7-6-17)14(15(20(24)25)10(2)18-9)11-4-3-5-12(8-11)19(22)23/h3-5,8,14,18H,6-7H2,1-2H3 |
| InChIKey | VTYAOZCTQUZILX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 124.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.22 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|