C31H28N4O5 — CID 14998987
[(E)-3-[4-(imidazol-1-ylmethyl)phenyl]prop-2-enyl] 5-(furan-2-yl)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate (PubChem CID 14998987) has the molecular formula C31H28N4O5 and a molecular weight of 536.59 g/mol. Its IUPAC name is [(E)-3-[4-(imidazol-1-ylmethyl)phenyl]prop-2-enyl] 5-(furan-2-yl)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate.
| Compound Name | [(E)-3-[4-(imidazol-1-ylmethyl)phenyl]prop-2-enyl] 5-(furan-2-yl)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 14998987 |
| Molecular Formula | C31H28N4O5 |
| Molecular Weight | 536.59 g/mol |
| Exact Mass | 536.21 |
| IUPAC Name | [(E)-3-[4-(imidazol-1-ylmethyl)phenyl]prop-2-enyl] 5-(furan-2-yl)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate |
| SMILES | CC1=C(C(=O)OC/C=C/c2ccc(Cn3ccnc3)cc2)C(c2cccc([N+](=O)[O-])c2)C(c2ccco2)=C(C)N1 |
| InChI | InChI=1S/C31H28N4O5/c1-21-28(27-9-5-16-39-27)30(25-7-3-8-26(18-25)35(37)38)29(22(2)33-21)31(36)40-17-4-6-23-10-12-24(13-11-23)19-34-15-14-32-20-34/h3-16,18,20,30,33H,17,19H2,1-2H3/b6-4+ |
| InChIKey | HFIKNOJEHSSNNJ-GQCTYLIASA-N |
| XLogP | 6.08 |
| TPSA | 112.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.59 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|