C29H28N4O6 — CID 67842800
1-[4-[4-(imidazol-1-ylmethyl)phenyl]but-3-enyl]-2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-3,5-dicarboxylic acid (PubChem CID 67842800) has the molecular formula C29H28N4O6 and a molecular weight of 528.57 g/mol. Its IUPAC name is 1-[4-[4-(imidazol-1-ylmethyl)phenyl]but-3-enyl]-2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-3,5-dicarboxylic acid.
| Compound Name | 1-[4-[4-(imidazol-1-ylmethyl)phenyl]but-3-enyl]-2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 67842800 |
| Molecular Formula | C29H28N4O6 |
| Molecular Weight | 528.57 g/mol |
| Exact Mass | 528.20 |
| IUPAC Name | 1-[4-[4-(imidazol-1-ylmethyl)phenyl]but-3-enyl]-2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-3,5-dicarboxylic acid |
| SMILES | CC1=C(C(=O)O)C(c2cccc([N+](=O)[O-])c2)C(C(=O)O)=C(C)N1CCC=Cc1ccc(Cn2ccnc2)cc1 |
| InChI | InChI=1S/C29H28N4O6/c1-19-25(28(34)35)27(23-7-5-8-24(16-23)33(38)39)26(29(36)37)20(2)32(19)14-4-3-6-21-9-11-22(12-10-21)17-31-15-13-30-18-31/h3,5-13,15-16,18,27H,4,14,17H2,1-2H3,(H,34,35)(H,36,37) |
| InChIKey | UGADPHAIVORGEQ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 138.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.57 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|