C30H32N4O7 — CID 54289478
3-O-ethyl 5-O-[2-[[4-(imidazol-1-ylmethyl)phenyl]methoxy]ethyl] 2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 54289478) has the molecular formula C30H32N4O7 and a molecular weight of 560.61 g/mol. Its IUPAC name is 3-O-ethyl 5-O-[2-[[4-(imidazol-1-ylmethyl)phenyl]methoxy]ethyl] 2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-ethyl 5-O-[2-[[4-(imidazol-1-ylmethyl)phenyl]methoxy]ethyl] 2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 54289478 |
| Molecular Formula | C30H32N4O7 |
| Molecular Weight | 560.61 g/mol |
| Exact Mass | 560.23 |
| IUPAC Name | 3-O-ethyl 5-O-[2-[[4-(imidazol-1-ylmethyl)phenyl]methoxy]ethyl] 2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1C(C)=NC(C)=C(C(=O)OCCOCc2ccc(Cn3ccnc3)cc2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C30H32N4O7/c1-4-40-29(35)26-20(2)32-21(3)27(28(26)24-6-5-7-25(16-24)34(37)38)30(36)41-15-14-39-18-23-10-8-22(9-11-23)17-33-13-12-31-19-33/h5-13,16,19,26,28H,4,14-15,17-18H2,1-3H3 |
| InChIKey | RWMJVURLDYQWOO-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 135.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.61 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|