C28H32N2O8 — CID 54261602
5-O-[3-[4-(2-methoxyethyl)phenoxy]propyl] 3-O-methyl (4R)-2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 54261602) has the molecular formula C28H32N2O8 and a molecular weight of 524.57 g/mol. Its IUPAC name is 5-O-[3-[4-(2-methoxyethyl)phenoxy]propyl] 3-O-methyl (4R)-2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-[3-[4-(2-methoxyethyl)phenoxy]propyl] 3-O-methyl (4R)-2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 54261602 |
| Molecular Formula | C28H32N2O8 |
| Molecular Weight | 524.57 g/mol |
| Exact Mass | 524.22 |
| IUPAC Name | 5-O-[3-[4-(2-methoxyethyl)phenoxy]propyl] 3-O-methyl (4R)-2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COCCc1ccc(OCCCOC(=O)C2=C(C)N=C(C)C(C(=O)OC)[C@@H]2c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C28H32N2O8/c1-18-24(27(31)36-4)26(21-7-5-8-22(17-21)30(33)34)25(19(2)29-18)28(32)38-15-6-14-37-23-11-9-20(10-12-23)13-16-35-3/h5,7-12,17,24,26H,6,13-16H2,1-4H3/t24?,26-/m0/s1 |
| InChIKey | RDXFQDBGMIYHRO-JKGBFCRXSA-N |
| XLogP | 4.42 |
| TPSA | 126.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.57 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|