C22H27N3O7 — CID 57303926
methyl 5-[(2-butoxy-2-oxoethyl)carbamoyl]-2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3-carboxylate (PubChem CID 57303926) has the molecular formula C22H27N3O7 and a molecular weight of 445.47 g/mol. Its IUPAC name is methyl 5-[(2-butoxy-2-oxoethyl)carbamoyl]-2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3-carboxylate.
| Compound Name | methyl 5-[(2-butoxy-2-oxoethyl)carbamoyl]-2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 57303926 |
| Molecular Formula | C22H27N3O7 |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | methyl 5-[(2-butoxy-2-oxoethyl)carbamoyl]-2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3-carboxylate |
| SMILES | CCCCOC(=O)CNC(=O)C1=C(C)N=C(C)C(C(=O)OC)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H27N3O7/c1-5-6-10-32-17(26)12-23-21(27)18-13(2)24-14(3)19(22(28)31-4)20(18)15-8-7-9-16(11-15)25(29)30/h7-9,11,19-20H,5-6,10,12H2,1-4H3,(H,23,27) |
| InChIKey | BBXUEXURKVMFSK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 137.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|