C24H23N3O7 — CID 54101820
2-[[3-methoxycarbonyl-2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-5-carbonyl]amino]-2-phenylacetic acid (PubChem CID 54101820) has the molecular formula C24H23N3O7 and a molecular weight of 465.46 g/mol. Its IUPAC name is 2-[[3-methoxycarbonyl-2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-5-carbonyl]amino]-2-phenylacetic acid.
| Compound Name | 2-[[3-methoxycarbonyl-2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-5-carbonyl]amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 54101820 |
| Molecular Formula | C24H23N3O7 |
| Molecular Weight | 465.46 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | 2-[[3-methoxycarbonyl-2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-5-carbonyl]amino]-2-phenylacetic acid |
| SMILES | COC(=O)C1C(C)=NC(C)=C(C(=O)NC(C(=O)O)c2ccccc2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H23N3O7/c1-13-18(22(28)26-21(23(29)30)15-8-5-4-6-9-15)20(19(14(2)25-13)24(31)34-3)16-10-7-11-17(12-16)27(32)33/h4-12,19-21H,1-3H3,(H,26,28)(H,29,30) |
| InChIKey | NAZVAVFSNUNDFP-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 148.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.46 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|