C17H17N3O7 — CID 57141825
dimethyl 6-carbamoyl-2-methyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 57141825) has the molecular formula C17H17N3O7 and a molecular weight of 375.34 g/mol. Its IUPAC name is dimethyl 6-carbamoyl-2-methyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | dimethyl 6-carbamoyl-2-methyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 57141825 |
| Molecular Formula | C17H17N3O7 |
| Molecular Weight | 375.34 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | dimethyl 6-carbamoyl-2-methyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(N)=O)N=C(C)C(C(=O)OC)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H17N3O7/c1-8-11(16(22)26-2)12(9-5-4-6-10(7-9)20(24)25)13(17(23)27-3)14(19-8)15(18)21/h4-7,11-12H,1-3H3,(H2,18,21) |
| InChIKey | IYUXIVKISADJGP-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 151.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.34 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|