C26H29N3O5 — CID 91025167
methyl 5-[3-[benzyl(methyl)amino]propanoyl]-2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3-carboxylate (PubChem CID 91025167) has the molecular formula C26H29N3O5 and a molecular weight of 463.53 g/mol. Its IUPAC name is methyl 5-[3-[benzyl(methyl)amino]propanoyl]-2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3-carboxylate.
| Compound Name | methyl 5-[3-[benzyl(methyl)amino]propanoyl]-2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 91025167 |
| Molecular Formula | C26H29N3O5 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | methyl 5-[3-[benzyl(methyl)amino]propanoyl]-2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3-carboxylate |
| SMILES | COC(=O)C1C(C)=NC(C)=C(C(=O)CCN(C)Cc2ccccc2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H29N3O5/c1-17-23(22(30)13-14-28(3)16-19-9-6-5-7-10-19)25(24(18(2)27-17)26(31)34-4)20-11-8-12-21(15-20)29(32)33/h5-12,15,24-25H,13-14,16H2,1-4H3 |
| InChIKey | QGUVCTWPVOREOH-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 102.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|