C23H32N4O6 — CID 57033298
bis[2-(dimethylamino)ethyl] 2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 57033298) has the molecular formula C23H32N4O6 and a molecular weight of 460.53 g/mol. Its IUPAC name is bis[2-(dimethylamino)ethyl] 2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | bis[2-(dimethylamino)ethyl] 2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 57033298 |
| Molecular Formula | C23H32N4O6 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | bis[2-(dimethylamino)ethyl] 2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CC1=NC(C)=C(C(=O)OCCN(C)C)C(c2cccc([N+](=O)[O-])c2)C1C(=O)OCCN(C)C |
| InChI | InChI=1S/C23H32N4O6/c1-15-19(22(28)32-12-10-25(3)4)21(17-8-7-9-18(14-17)27(30)31)20(16(2)24-15)23(29)33-13-11-26(5)6/h7-9,14,19,21H,10-13H2,1-6H3 |
| InChIKey | JJFDHHCTNCFRSH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 114.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|