C37H42N4O7 — CID 54173010
3-O-(2-methoxyethyl) 5-O-[2-[methyl-[2-methyl-3-[4-(pyridin-3-ylmethyl)phenyl]prop-2-enyl]amino]ethyl] 2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 54173010) has the molecular formula C37H42N4O7 and a molecular weight of 654.76 g/mol. Its IUPAC name is 3-O-(2-methoxyethyl) 5-O-[2-[methyl-[2-methyl-3-[4-(pyridin-3-ylmethyl)phenyl]prop-2-enyl]amino]ethyl] 2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-(2-methoxyethyl) 5-O-[2-[methyl-[2-methyl-3-[4-(pyridin-3-ylmethyl)phenyl]prop-2-enyl]amino]ethyl] 2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 54173010 |
| Molecular Formula | C37H42N4O7 |
| Molecular Weight | 654.76 g/mol |
| Exact Mass | 654.31 |
| IUPAC Name | 3-O-(2-methoxyethyl) 5-O-[2-[methyl-[2-methyl-3-[4-(pyridin-3-ylmethyl)phenyl]prop-2-enyl]amino]ethyl] 2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COCCOC(=O)C1C(C)=NC(C)=C(C(=O)OCCN(C)CC(C)=Cc2ccc(Cc3cccnc3)cc2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C37H42N4O7/c1-25(20-28-11-13-29(14-12-28)21-30-8-7-15-38-23-30)24-40(4)16-17-47-36(42)33-26(2)39-27(3)34(37(43)48-19-18-46-5)35(33)31-9-6-10-32(22-31)41(44)45/h6-15,20,22-23,34-35H,16-19,21,24H2,1-5H3 |
| InChIKey | OWIKLYJYFGJGKM-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 133.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.76 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|