C20H26N2O6 — CID 57306082
bis(2-methoxyethyl) 2,6-dimethyl-4-pyridin-3-yl-3,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 57306082) has the molecular formula C20H26N2O6 and a molecular weight of 390.44 g/mol. Its IUPAC name is bis(2-methoxyethyl) 2,6-dimethyl-4-pyridin-3-yl-3,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | bis(2-methoxyethyl) 2,6-dimethyl-4-pyridin-3-yl-3,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 57306082 |
| Molecular Formula | C20H26N2O6 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | bis(2-methoxyethyl) 2,6-dimethyl-4-pyridin-3-yl-3,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COCCOC(=O)C1=C(C)N=C(C)C(C(=O)OCCOC)C1c1cccnc1 |
| InChI | InChI=1S/C20H26N2O6/c1-13-16(19(23)27-10-8-25-3)18(15-6-5-7-21-12-15)17(14(2)22-13)20(24)28-11-9-26-4/h5-7,12,16,18H,8-11H2,1-4H3 |
| InChIKey | KZWBBDIEVRMCHS-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 96.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|