C21H25N3O5 — CID 54244166
5-O-(2-cyanoethyl) 3-O-(2-methoxyethyl) 4-(3-aminophenyl)-2,6-dimethyl-3,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 54244166) has the molecular formula C21H25N3O5 and a molecular weight of 399.45 g/mol. Its IUPAC name is 5-O-(2-cyanoethyl) 3-O-(2-methoxyethyl) 4-(3-aminophenyl)-2,6-dimethyl-3,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-(2-cyanoethyl) 3-O-(2-methoxyethyl) 4-(3-aminophenyl)-2,6-dimethyl-3,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 54244166 |
| Molecular Formula | C21H25N3O5 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 5-O-(2-cyanoethyl) 3-O-(2-methoxyethyl) 4-(3-aminophenyl)-2,6-dimethyl-3,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COCCOC(=O)C1C(C)=NC(C)=C(C(=O)OCCC#N)C1c1cccc(N)c1 |
| InChI | InChI=1S/C21H25N3O5/c1-13-17(20(25)28-9-5-8-22)19(15-6-4-7-16(23)12-15)18(14(2)24-13)21(26)29-11-10-27-3/h4,6-7,12,18-19H,5,9-11,23H2,1-3H3 |
| InChIKey | QSBMFLBMRDTMBI-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 124.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|