C19H23NO6 — CID 54176681
5-(2-methoxyethoxycarbonyl)-4-(3-methoxyphenyl)-2,6-dimethyl-3,4-dihydropyridine-3-carboxylic acid (PubChem CID 54176681) has the molecular formula C19H23NO6 and a molecular weight of 361.39 g/mol. Its IUPAC name is 5-(2-methoxyethoxycarbonyl)-4-(3-methoxyphenyl)-2,6-dimethyl-3,4-dihydropyridine-3-carboxylic acid.
| Compound Name | 5-(2-methoxyethoxycarbonyl)-4-(3-methoxyphenyl)-2,6-dimethyl-3,4-dihydropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 54176681 |
| Molecular Formula | C19H23NO6 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 5-(2-methoxyethoxycarbonyl)-4-(3-methoxyphenyl)-2,6-dimethyl-3,4-dihydropyridine-3-carboxylic acid |
| SMILES | COCCOC(=O)C1=C(C)N=C(C)C(C(=O)O)C1c1cccc(OC)c1 |
| InChI | InChI=1S/C19H23NO6/c1-11-15(18(21)22)17(13-6-5-7-14(10-13)25-4)16(12(2)20-11)19(23)26-9-8-24-3/h5-7,10,15,17H,8-9H2,1-4H3,(H,21,22) |
| InChIKey | OYWPJHFPWYSICO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 94.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|