C26H26ClN3O4 — CID 57310169
2-cyanoethyl 4-(3-chlorophenyl)-2,6-dimethyl-5-(2-phenoxyethylcarbamoyl)-3,4-dihydropyridine-3-carboxylate (PubChem CID 57310169) has the molecular formula C26H26ClN3O4 and a molecular weight of 479.96 g/mol. Its IUPAC name is 2-cyanoethyl 4-(3-chlorophenyl)-2,6-dimethyl-5-(2-phenoxyethylcarbamoyl)-3,4-dihydropyridine-3-carboxylate.
| Compound Name | 2-cyanoethyl 4-(3-chlorophenyl)-2,6-dimethyl-5-(2-phenoxyethylcarbamoyl)-3,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 57310169 |
| Molecular Formula | C26H26ClN3O4 |
| Molecular Weight | 479.96 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | 2-cyanoethyl 4-(3-chlorophenyl)-2,6-dimethyl-5-(2-phenoxyethylcarbamoyl)-3,4-dihydropyridine-3-carboxylate |
| SMILES | CC1=NC(C)=C(C(=O)NCCOc2ccccc2)C(c2cccc(Cl)c2)C1C(=O)OCCC#N |
| InChI | InChI=1S/C26H26ClN3O4/c1-17-22(25(31)29-13-15-33-21-10-4-3-5-11-21)24(19-8-6-9-20(27)16-19)23(18(2)30-17)26(32)34-14-7-12-28/h3-6,8-11,16,23-24H,7,13-15H2,1-2H3,(H,29,31) |
| InChIKey | DPZLHWPZACUATP-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.96 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|