C16H15ClN2O2S — CID 7736585
ethyl (4S)-4-(3-chlorophenyl)-5-cyano-2-methyl-6-sulfanyl-3,4-dihydropyridine-3-carboxylate (PubChem CID 7736585) has the molecular formula C16H15ClN2O2S and a molecular weight of 334.83 g/mol. Its IUPAC name is ethyl (4S)-4-(3-chlorophenyl)-5-cyano-2-methyl-6-sulfanyl-3,4-dihydropyridine-3-carboxylate.
| Compound Name | ethyl (4S)-4-(3-chlorophenyl)-5-cyano-2-methyl-6-sulfanyl-3,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 7736585 |
| Molecular Formula | C16H15ClN2O2S |
| Molecular Weight | 334.83 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | ethyl (4S)-4-(3-chlorophenyl)-5-cyano-2-methyl-6-sulfanyl-3,4-dihydropyridine-3-carboxylate |
| SMILES | CCOC(=O)C1C(C)=NC(S)=C(C#N)[C@@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H15ClN2O2S/c1-3-21-16(20)13-9(2)19-15(22)12(8-18)14(13)10-5-4-6-11(17)7-10/h4-7,13-14,22H,3H2,1-2H3/t13?,14-/m0/s1 |
| InChIKey | NLPMVXWGOYCAIE-KZUDCZAMSA-N |
| XLogP | 3.74 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.83 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|