C19H15N4O2- — CID 7308437
[2-cyano-2-[(4R)-5-cyano-3-ethoxycarbonyl-2-methyl-4-phenyl-3,4-dihydropyridin-6-yl]ethenylidene]azanide (PubChem CID 7308437) has the molecular formula C19H15N4O2- and a molecular weight of 331.36 g/mol. Its IUPAC name is [2-cyano-2-[(4R)-5-cyano-3-ethoxycarbonyl-2-methyl-4-phenyl-3,4-dihydropyridin-6-yl]ethenylidene]azanide.
| Compound Name | [2-cyano-2-[(4R)-5-cyano-3-ethoxycarbonyl-2-methyl-4-phenyl-3,4-dihydropyridin-6-yl]ethenylidene]azanide |
|---|---|
| PubChem CID | 7308437 |
| Molecular Formula | C19H15N4O2- |
| Molecular Weight | 331.36 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | [2-cyano-2-[(4R)-5-cyano-3-ethoxycarbonyl-2-methyl-4-phenyl-3,4-dihydropyridin-6-yl]ethenylidene]azanide |
| SMILES | CCOC(=O)C1C(C)=NC(C(=C=[N-])C#N)=C(C#N)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C19H15N4O2/c1-3-25-19(24)16-12(2)23-18(14(9-20)10-21)15(11-22)17(16)13-7-5-4-6-8-13/h4-8,16-17H,3H2,1-2H3/q-1/t16?,17-/m1/s1 |
| InChIKey | RYCPOHUJEZYIRV-ZYMOGRSISA-N |
| XLogP | 2.89 |
| TPSA | 108.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|