C16H15N3O2S — CID 7336573
prop-2-enyl (4R)-5-cyano-2-methyl-4-pyridin-3-yl-6-sulfanyl-3,4-dihydropyridine-3-carboxylate (PubChem CID 7336573) has the molecular formula C16H15N3O2S and a molecular weight of 313.38 g/mol. Its IUPAC name is prop-2-enyl (4R)-5-cyano-2-methyl-4-pyridin-3-yl-6-sulfanyl-3,4-dihydropyridine-3-carboxylate.
| Compound Name | prop-2-enyl (4R)-5-cyano-2-methyl-4-pyridin-3-yl-6-sulfanyl-3,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 7336573 |
| Molecular Formula | C16H15N3O2S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | prop-2-enyl (4R)-5-cyano-2-methyl-4-pyridin-3-yl-6-sulfanyl-3,4-dihydropyridine-3-carboxylate |
| SMILES | C=CCOC(=O)C1C(C)=NC(S)=C(C#N)[C@H]1c1cccnc1 |
| InChI | InChI=1S/C16H15N3O2S/c1-3-7-21-16(20)13-10(2)19-15(22)12(8-17)14(13)11-5-4-6-18-9-11/h3-6,9,13-14,22H,1,7H2,2H3/t13?,14-/m1/s1 |
| InChIKey | LYWQZCIYYARQOS-ARLHGKGLSA-N |
| XLogP | 2.65 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|