C31H27ClN2O4 — CID 70120843
5-O-benzhydryl 3-O-(2-cyanoethyl) 4-(3-chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 70120843) has the molecular formula C31H27ClN2O4 and a molecular weight of 527.02 g/mol. Its IUPAC name is 5-O-benzhydryl 3-O-(2-cyanoethyl) 4-(3-chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-benzhydryl 3-O-(2-cyanoethyl) 4-(3-chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 70120843 |
| Molecular Formula | C31H27ClN2O4 |
| Molecular Weight | 527.02 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | 5-O-benzhydryl 3-O-(2-cyanoethyl) 4-(3-chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CC1=C(C(=O)OCCC#N)C(c2cccc(Cl)c2)C(C(=O)OC(c2ccccc2)c2ccccc2)=C(C)N1 |
| InChI | InChI=1S/C31H27ClN2O4/c1-20-26(30(35)37-18-10-17-33)28(24-15-9-16-25(32)19-24)27(21(2)34-20)31(36)38-29(22-11-5-3-6-12-22)23-13-7-4-8-14-23/h3-9,11-16,19,28-29,34H,10,18H2,1-2H3 |
| InChIKey | NMTMVVHQUADYGF-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.02 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|