C18H16Cl2N2O4 — CID 151340647
5-(2-cyanoethoxycarbonyl)-4-(3,4-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid (PubChem CID 151340647) has the molecular formula C18H16Cl2N2O4 and a molecular weight of 395.24 g/mol. Its IUPAC name is 5-(2-cyanoethoxycarbonyl)-4-(3,4-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid.
| Compound Name | 5-(2-cyanoethoxycarbonyl)-4-(3,4-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 151340647 |
| Molecular Formula | C18H16Cl2N2O4 |
| Molecular Weight | 395.24 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | 5-(2-cyanoethoxycarbonyl)-4-(3,4-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid |
| SMILES | CC1=C(C(=O)O)C(c2ccc(Cl)c(Cl)c2)C(C(=O)OCCC#N)=C(C)N1 |
| InChI | InChI=1S/C18H16Cl2N2O4/c1-9-14(17(23)24)16(11-4-5-12(19)13(20)8-11)15(10(2)22-9)18(25)26-7-3-6-21/h4-5,8,16,22H,3,7H2,1-2H3,(H,23,24) |
| InChIKey | OKKAHPMTSFKJFL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.24 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|