C21H23Cl2NO6 — CID 154636828
5-O-(butanoyloxymethyl) 3-O-methyl 4-(3,4-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 154636828) has the molecular formula C21H23Cl2NO6 and a molecular weight of 456.32 g/mol. Its IUPAC name is 5-O-(butanoyloxymethyl) 3-O-methyl 4-(3,4-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-(butanoyloxymethyl) 3-O-methyl 4-(3,4-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 154636828 |
| Molecular Formula | C21H23Cl2NO6 |
| Molecular Weight | 456.32 g/mol |
| Exact Mass | 455.09 |
| IUPAC Name | 5-O-(butanoyloxymethyl) 3-O-methyl 4-(3,4-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCCC(=O)OCOC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H23Cl2NO6/c1-5-6-16(25)29-10-30-21(27)18-12(3)24-11(2)17(20(26)28-4)19(18)13-7-8-14(22)15(23)9-13/h7-9,19,24H,5-6,10H2,1-4H3 |
| InChIKey | WXLSWAHPJQTWGX-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.32 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|