C34H33ClN2O4 — CID 70119641
5-O-(2-cyanoethyl) 3-O-(4,4-diphenylbutyl) 4-(3-chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 70119641) has the molecular formula C34H33ClN2O4 and a molecular weight of 569.10 g/mol. Its IUPAC name is 5-O-(2-cyanoethyl) 3-O-(4,4-diphenylbutyl) 4-(3-chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-(2-cyanoethyl) 3-O-(4,4-diphenylbutyl) 4-(3-chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 70119641 |
| Molecular Formula | C34H33ClN2O4 |
| Molecular Weight | 569.10 g/mol |
| Exact Mass | 568.21 |
| IUPAC Name | 5-O-(2-cyanoethyl) 3-O-(4,4-diphenylbutyl) 4-(3-chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CC1=C(C(=O)OCCC#N)C(c2cccc(Cl)c2)C(C(=O)OCCCC(c2ccccc2)c2ccccc2)=C(C)N1 |
| InChI | InChI=1S/C34H33ClN2O4/c1-23-30(32(27-16-9-17-28(35)22-27)31(24(2)37-23)34(39)41-21-11-19-36)33(38)40-20-10-18-29(25-12-5-3-6-13-25)26-14-7-4-8-15-26/h3-9,12-17,22,29,32,37H,10-11,18,20-21H2,1-2H3 |
| InChIKey | MEWHYKZTXBNESW-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.10 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|