C30H33ClN4O3 — CID 18318259
2-cyanoethyl 5-[(1-benzylpiperidin-4-yl)carbamoyl]-4-(3-chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate (PubChem CID 18318259) has the molecular formula C30H33ClN4O3 and a molecular weight of 533.07 g/mol. Its IUPAC name is 2-cyanoethyl 5-[(1-benzylpiperidin-4-yl)carbamoyl]-4-(3-chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate.
| Compound Name | 2-cyanoethyl 5-[(1-benzylpiperidin-4-yl)carbamoyl]-4-(3-chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 18318259 |
| Molecular Formula | C30H33ClN4O3 |
| Molecular Weight | 533.07 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | 2-cyanoethyl 5-[(1-benzylpiperidin-4-yl)carbamoyl]-4-(3-chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate |
| SMILES | CC1=C(C(=O)NC2CCN(Cc3ccccc3)CC2)C(c2cccc(Cl)c2)C(C(=O)OCCC#N)=C(C)N1 |
| InChI | InChI=1S/C30H33ClN4O3/c1-20-26(29(36)34-25-12-15-35(16-13-25)19-22-8-4-3-5-9-22)28(23-10-6-11-24(31)18-23)27(21(2)33-20)30(37)38-17-7-14-32/h3-6,8-11,18,25,28,33H,7,12-13,15-17,19H2,1-2H3,(H,34,36) |
| InChIKey | AJQHOZASOQGFRK-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.07 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|