C36H41N3O6 — CID 57036049
5-O-[3-[4,4-diphenylbutan-2-yl(methyl)amino]propyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 57036049) has the molecular formula C36H41N3O6 and a molecular weight of 611.74 g/mol. Its IUPAC name is 5-O-[3-[4,4-diphenylbutan-2-yl(methyl)amino]propyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-[3-[4,4-diphenylbutan-2-yl(methyl)amino]propyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 57036049 |
| Molecular Formula | C36H41N3O6 |
| Molecular Weight | 611.74 g/mol |
| Exact Mass | 611.30 |
| IUPAC Name | 5-O-[3-[4,4-diphenylbutan-2-yl(methyl)amino]propyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1C(C)=NC(C)=C(C(=O)OCCCN(C)C(C)CC(c2ccccc2)c2ccccc2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C36H41N3O6/c1-24(22-31(27-14-8-6-9-15-27)28-16-10-7-11-17-28)38(4)20-13-21-45-36(41)33-26(3)37-25(2)32(35(40)44-5)34(33)29-18-12-19-30(23-29)39(42)43/h6-12,14-19,23-24,31-32,34H,13,20-22H2,1-5H3 |
| InChIKey | ZJQJZPBSXYECCD-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 111.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.74 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|