C27H31N3O8 — CID 57199388
5-O-[2-(2,3-dihydroxy-N-propylanilino)ethyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 57199388) has the molecular formula C27H31N3O8 and a molecular weight of 525.56 g/mol. Its IUPAC name is 5-O-[2-(2,3-dihydroxy-N-propylanilino)ethyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-[2-(2,3-dihydroxy-N-propylanilino)ethyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 57199388 |
| Molecular Formula | C27H31N3O8 |
| Molecular Weight | 525.56 g/mol |
| Exact Mass | 525.21 |
| IUPAC Name | 5-O-[2-(2,3-dihydroxy-N-propylanilino)ethyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCCN(CCOC(=O)C1=C(C)N=C(C)C(C(=O)OC)C1c1cccc([N+](=O)[O-])c1)c1cccc(O)c1O |
| InChI | InChI=1S/C27H31N3O8/c1-5-12-29(20-10-7-11-21(31)25(20)32)13-14-38-27(34)23-17(3)28-16(2)22(26(33)37-4)24(23)18-8-6-9-19(15-18)30(35)36/h6-11,15,22,24,31-32H,5,12-14H2,1-4H3 |
| InChIKey | DAEBZYDZLIFXJB-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 151.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.56 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|