C29H39N3O9 — CID 54163347
ditert-butyl (2S)-2-[[(4R)-3-methoxycarbonyl-2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-5-carbonyl]amino]pentanedioate (PubChem CID 54163347) has the molecular formula C29H39N3O9 and a molecular weight of 573.64 g/mol. Its IUPAC name is ditert-butyl (2S)-2-[[(4R)-3-methoxycarbonyl-2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-5-carbonyl]amino]pentanedioate.
| Compound Name | ditert-butyl (2S)-2-[[(4R)-3-methoxycarbonyl-2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-5-carbonyl]amino]pentanedioate |
|---|---|
| PubChem CID | 54163347 |
| Molecular Formula | C29H39N3O9 |
| Molecular Weight | 573.64 g/mol |
| Exact Mass | 573.27 |
| IUPAC Name | ditert-butyl (2S)-2-[[(4R)-3-methoxycarbonyl-2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-5-carbonyl]amino]pentanedioate |
| SMILES | COC(=O)C1C(C)=NC(C)=C(C(=O)N[C@@H](CCC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)[C@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H39N3O9/c1-16-22(24(23(17(2)30-16)27(36)39-9)18-11-10-12-19(15-18)32(37)38)25(34)31-20(26(35)41-29(6,7)8)13-14-21(33)40-28(3,4)5/h10-12,15,20,23-24H,13-14H2,1-9H3,(H,31,34)/t20-,23?,24+/m0/s1 |
| InChIKey | OPYKIIVDYPBNHQ-OTHQKOMUSA-N |
| XLogP | 4.16 |
| TPSA | 163.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.64 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|