C34H42N2O8S — CID 54194411
3-O-methyl 5-O-[4-[4-[3-(oxan-2-yloxy)propyl]phenyl]sulfanylbutyl] 2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 54194411) has the molecular formula C34H42N2O8S and a molecular weight of 638.78 g/mol. Its IUPAC name is 3-O-methyl 5-O-[4-[4-[3-(oxan-2-yloxy)propyl]phenyl]sulfanylbutyl] 2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-methyl 5-O-[4-[4-[3-(oxan-2-yloxy)propyl]phenyl]sulfanylbutyl] 2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 54194411 |
| Molecular Formula | C34H42N2O8S |
| Molecular Weight | 638.78 g/mol |
| Exact Mass | 638.27 |
| IUPAC Name | 3-O-methyl 5-O-[4-[4-[3-(oxan-2-yloxy)propyl]phenyl]sulfanylbutyl] 2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1C(C)=NC(C)=C(C(=O)OCCCCSc2ccc(CCCOC3CCCCO3)cc2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C34H42N2O8S/c1-23-30(33(37)41-3)32(26-11-8-12-27(22-26)36(39)40)31(24(2)35-23)34(38)44-19-6-7-21-45-28-16-14-25(15-17-28)10-9-20-43-29-13-4-5-18-42-29/h8,11-12,14-17,22,29-30,32H,4-7,9-10,13,18-21H2,1-3H3 |
| InChIKey | PKUFNUDYECPFOW-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 126.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.78 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|