C29H28N4O8 — CID 54337156
5-O-[2-[4-(imidazol-1-ylmethyl)benzoyl]oxyethyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 54337156) has the molecular formula C29H28N4O8 and a molecular weight of 560.56 g/mol. Its IUPAC name is 5-O-[2-[4-(imidazol-1-ylmethyl)benzoyl]oxyethyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-[2-[4-(imidazol-1-ylmethyl)benzoyl]oxyethyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 54337156 |
| Molecular Formula | C29H28N4O8 |
| Molecular Weight | 560.56 g/mol |
| Exact Mass | 560.19 |
| IUPAC Name | 5-O-[2-[4-(imidazol-1-ylmethyl)benzoyl]oxyethyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1C(C)=NC(C)=C(C(=O)OCCOC(=O)c2ccc(Cn3ccnc3)cc2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H28N4O8/c1-18-24(28(35)39-3)26(22-5-4-6-23(15-22)33(37)38)25(19(2)31-18)29(36)41-14-13-40-27(34)21-9-7-20(8-10-21)16-32-12-11-30-17-32/h4-12,15,17,24,26H,13-14,16H2,1-3H3 |
| InChIKey | TWHCRRBSKXLVSW-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 152.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.56 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|