C31H36N2O9 — CID 70427261
3-O-methyl 5-O-[2-[4-[2-(oxan-2-yloxy)ethyl]phenoxy]ethyl] (4S)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 70427261) has the molecular formula C31H36N2O9 and a molecular weight of 580.63 g/mol. Its IUPAC name is 3-O-methyl 5-O-[2-[4-[2-(oxan-2-yloxy)ethyl]phenoxy]ethyl] (4S)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-methyl 5-O-[2-[4-[2-(oxan-2-yloxy)ethyl]phenoxy]ethyl] (4S)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 70427261 |
| Molecular Formula | C31H36N2O9 |
| Molecular Weight | 580.63 g/mol |
| Exact Mass | 580.24 |
| IUPAC Name | 3-O-methyl 5-O-[2-[4-[2-(oxan-2-yloxy)ethyl]phenoxy]ethyl] (4S)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OCCOc2ccc(CCOC3CCCCO3)cc2)[C@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C31H36N2O9/c1-20-27(30(34)38-3)29(23-7-6-8-24(19-23)33(36)37)28(21(2)32-20)31(35)42-18-17-39-25-12-10-22(11-13-25)14-16-41-26-9-4-5-15-40-26/h6-8,10-13,19,26,29,32H,4-5,9,14-18H2,1-3H3/t26?,29-/m0/s1 |
| InChIKey | SJXAKLRKQPQDJB-BTMGADRYSA-N |
| XLogP | 4.71 |
| TPSA | 135.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.63 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|