C28H28BrF3N2O7 — CID 139680716
3-O-[2-[4-(4-bromobutoxy)phenyl]ethyl] 5-O-methyl 2-methyl-4-(3-nitrophenyl)-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 139680716) has the molecular formula C28H28BrF3N2O7 and a molecular weight of 641.44 g/mol. Its IUPAC name is 3-O-[2-[4-(4-bromobutoxy)phenyl]ethyl] 5-O-methyl 2-methyl-4-(3-nitrophenyl)-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-[2-[4-(4-bromobutoxy)phenyl]ethyl] 5-O-methyl 2-methyl-4-(3-nitrophenyl)-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 139680716 |
| Molecular Formula | C28H28BrF3N2O7 |
| Molecular Weight | 641.44 g/mol |
| Exact Mass | 640.10 |
| IUPAC Name | 3-O-[2-[4-(4-bromobutoxy)phenyl]ethyl] 5-O-methyl 2-methyl-4-(3-nitrophenyl)-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(F)(F)F)NC(C)=C(C(=O)OCCc2ccc(OCCCCBr)cc2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H28BrF3N2O7/c1-17-22(27(36)41-15-12-18-8-10-21(11-9-18)40-14-4-3-13-29)23(19-6-5-7-20(16-19)34(37)38)24(26(35)39-2)25(33-17)28(30,31)32/h5-11,16,23,33H,3-4,12-15H2,1-2H3 |
| InChIKey | OVECJHZSYAANEZ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.44 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|