C22H24BrClF3NO4 — CID 70070805
3-O-(6-bromohexyl) 5-O-methyl 4-(3-chlorophenyl)-2-methyl-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 70070805) has the molecular formula C22H24BrClF3NO4 and a molecular weight of 538.79 g/mol. Its IUPAC name is 3-O-(6-bromohexyl) 5-O-methyl 4-(3-chlorophenyl)-2-methyl-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-(6-bromohexyl) 5-O-methyl 4-(3-chlorophenyl)-2-methyl-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 70070805 |
| Molecular Formula | C22H24BrClF3NO4 |
| Molecular Weight | 538.79 g/mol |
| Exact Mass | 537.05 |
| IUPAC Name | 3-O-(6-bromohexyl) 5-O-methyl 4-(3-chlorophenyl)-2-methyl-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(F)(F)F)NC(C)=C(C(=O)OCCCCCCBr)C1c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H24BrClF3NO4/c1-13-16(21(30)32-11-6-4-3-5-10-23)17(14-8-7-9-15(24)12-14)18(20(29)31-2)19(28-13)22(25,26)27/h7-9,12,17,28H,3-6,10-11H2,1-2H3 |
| InChIKey | LQMWWEPQLSYJFS-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.79 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|