C23H26BrF3N2O6 — CID 70067778
3-O-(6-bromohexyl) 5-O-ethyl 2-methyl-4-(3-nitrophenyl)-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 70067778) has the molecular formula C23H26BrF3N2O6 and a molecular weight of 563.37 g/mol. Its IUPAC name is 3-O-(6-bromohexyl) 5-O-ethyl 2-methyl-4-(3-nitrophenyl)-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-(6-bromohexyl) 5-O-ethyl 2-methyl-4-(3-nitrophenyl)-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 70067778 |
| Molecular Formula | C23H26BrF3N2O6 |
| Molecular Weight | 563.37 g/mol |
| Exact Mass | 562.09 |
| IUPAC Name | 3-O-(6-bromohexyl) 5-O-ethyl 2-methyl-4-(3-nitrophenyl)-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C(F)(F)F)NC(C)=C(C(=O)OCCCCCCBr)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H26BrF3N2O6/c1-3-34-22(31)19-18(15-9-8-10-16(13-15)29(32)33)17(14(2)28-20(19)23(25,26)27)21(30)35-12-7-5-4-6-11-24/h8-10,13,18,28H,3-7,11-12H2,1-2H3 |
| InChIKey | CCIQBHBAGQLWIX-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.37 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|