C23H26BrF3N2O7 — CID 67860298
diethyl 4-[2-(4-bromobutoxy)-5-nitrophenyl]-2-methyl-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 67860298) has the molecular formula C23H26BrF3N2O7 and a molecular weight of 579.37 g/mol. Its IUPAC name is diethyl 4-[2-(4-bromobutoxy)-5-nitrophenyl]-2-methyl-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | diethyl 4-[2-(4-bromobutoxy)-5-nitrophenyl]-2-methyl-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 67860298 |
| Molecular Formula | C23H26BrF3N2O7 |
| Molecular Weight | 579.37 g/mol |
| Exact Mass | 578.09 |
| IUPAC Name | diethyl 4-[2-(4-bromobutoxy)-5-nitrophenyl]-2-methyl-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(C(F)(F)F)=C(C(=O)OCC)C1c1cc([N+](=O)[O-])ccc1OCCCCBr |
| InChI | InChI=1S/C23H26BrF3N2O7/c1-4-34-21(30)17-13(3)28-20(23(25,26)27)19(22(31)35-5-2)18(17)15-12-14(29(32)33)8-9-16(15)36-11-7-6-10-24/h8-9,12,18,28H,4-7,10-11H2,1-3H3 |
| InChIKey | ZTLFOVZXCJMTQJ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.37 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|