C23H26BrN3O7 — CID 70080671
3-O-methyl 5-O-propan-2-yl 4-[2-(4-bromobutoxy)-5-nitrophenyl]-2-cyano-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 70080671) has the molecular formula C23H26BrN3O7 and a molecular weight of 536.38 g/mol. Its IUPAC name is 3-O-methyl 5-O-propan-2-yl 4-[2-(4-bromobutoxy)-5-nitrophenyl]-2-cyano-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-methyl 5-O-propan-2-yl 4-[2-(4-bromobutoxy)-5-nitrophenyl]-2-cyano-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 70080671 |
| Molecular Formula | C23H26BrN3O7 |
| Molecular Weight | 536.38 g/mol |
| Exact Mass | 535.10 |
| IUPAC Name | 3-O-methyl 5-O-propan-2-yl 4-[2-(4-bromobutoxy)-5-nitrophenyl]-2-cyano-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C#N)NC(C)=C(C(=O)OC(C)C)C1c1cc([N+](=O)[O-])ccc1OCCCCBr |
| InChI | InChI=1S/C23H26BrN3O7/c1-13(2)34-23(29)19-14(3)26-17(12-25)21(22(28)32-4)20(19)16-11-15(27(30)31)7-8-18(16)33-10-6-5-9-24/h7-8,11,13,20,26H,5-6,9-10H2,1-4H3 |
| InChIKey | PPRBNOKPZQERHA-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 140.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.38 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|