C30H34N4O8 — CID 70056472
5-O-[2-[2-(3-amino-2-hydroxy-4-methylpentoxy)phenyl]ethyl] 3-O-methyl 2-cyano-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 70056472) has the molecular formula C30H34N4O8 and a molecular weight of 578.62 g/mol. Its IUPAC name is 5-O-[2-[2-(3-amino-2-hydroxy-4-methylpentoxy)phenyl]ethyl] 3-O-methyl 2-cyano-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-[2-[2-(3-amino-2-hydroxy-4-methylpentoxy)phenyl]ethyl] 3-O-methyl 2-cyano-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 70056472 |
| Molecular Formula | C30H34N4O8 |
| Molecular Weight | 578.62 g/mol |
| Exact Mass | 578.24 |
| IUPAC Name | 5-O-[2-[2-(3-amino-2-hydroxy-4-methylpentoxy)phenyl]ethyl] 3-O-methyl 2-cyano-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C#N)NC(C)=C(C(=O)OCCc2ccccc2OCC(O)C(N)C(C)C)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C30H34N4O8/c1-17(2)28(32)23(35)16-42-24-11-6-5-8-19(24)12-13-41-30(37)25-18(3)33-22(15-31)27(29(36)40-4)26(25)20-9-7-10-21(14-20)34(38)39/h5-11,14,17,23,26,28,33,35H,12-13,16,32H2,1-4H3 |
| InChIKey | ITAHVBMKAJAPGR-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 187.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.62 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|