C32H38N4O8 — CID 70472091
5-O-[6-[[3-(2-cyanophenoxy)-2-hydroxypropyl]amino]hexyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 70472091) has the molecular formula C32H38N4O8 and a molecular weight of 606.68 g/mol. Its IUPAC name is 5-O-[6-[[3-(2-cyanophenoxy)-2-hydroxypropyl]amino]hexyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-[6-[[3-(2-cyanophenoxy)-2-hydroxypropyl]amino]hexyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 70472091 |
| Molecular Formula | C32H38N4O8 |
| Molecular Weight | 606.68 g/mol |
| Exact Mass | 606.27 |
| IUPAC Name | 5-O-[6-[[3-(2-cyanophenoxy)-2-hydroxypropyl]amino]hexyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OCCCCCCNCC(O)COc2ccccc2C#N)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C32H38N4O8/c1-21-28(31(38)42-3)30(23-12-10-13-25(17-23)36(40)41)29(22(2)35-21)32(39)43-16-9-5-4-8-15-34-19-26(37)20-44-27-14-7-6-11-24(27)18-33/h6-7,10-14,17,26,30,34-35,37H,4-5,8-9,15-16,19-20H2,1-3H3 |
| InChIKey | RWSUTKUQEWGCLS-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 173.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.68 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|