C29H32F3N3O9 — CID 139680694
3-O-[2-[2-[(2-hydroxy-3-phenoxypropyl)amino]ethoxy]ethyl] 5-O-methyl 2-methyl-4-(3-nitrophenyl)-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 139680694) has the molecular formula C29H32F3N3O9 and a molecular weight of 623.58 g/mol. Its IUPAC name is 3-O-[2-[2-[(2-hydroxy-3-phenoxypropyl)amino]ethoxy]ethyl] 5-O-methyl 2-methyl-4-(3-nitrophenyl)-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-[2-[2-[(2-hydroxy-3-phenoxypropyl)amino]ethoxy]ethyl] 5-O-methyl 2-methyl-4-(3-nitrophenyl)-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 139680694 |
| Molecular Formula | C29H32F3N3O9 |
| Molecular Weight | 623.58 g/mol |
| Exact Mass | 623.21 |
| IUPAC Name | 3-O-[2-[2-[(2-hydroxy-3-phenoxypropyl)amino]ethoxy]ethyl] 5-O-methyl 2-methyl-4-(3-nitrophenyl)-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(F)(F)F)NC(C)=C(C(=O)OCCOCCNCC(O)COc2ccccc2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H32F3N3O9/c1-18-23(28(38)43-14-13-42-12-11-33-16-21(36)17-44-22-9-4-3-5-10-22)24(19-7-6-8-20(15-19)35(39)40)25(27(37)41-2)26(34-18)29(30,31)32/h3-10,15,21,24,33-34,36H,11-14,16-17H2,1-2H3 |
| InChIKey | GKSJCZQPEZVFHG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 158.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.58 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|