C32H38F3N3O9 — CID 67860339
diethyl 4-[2-[4-[(2-hydroxy-3-phenoxypropyl)amino]butoxy]-5-nitrophenyl]-2-methyl-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 67860339) has the molecular formula C32H38F3N3O9 and a molecular weight of 665.66 g/mol. Its IUPAC name is diethyl 4-[2-[4-[(2-hydroxy-3-phenoxypropyl)amino]butoxy]-5-nitrophenyl]-2-methyl-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | diethyl 4-[2-[4-[(2-hydroxy-3-phenoxypropyl)amino]butoxy]-5-nitrophenyl]-2-methyl-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 67860339 |
| Molecular Formula | C32H38F3N3O9 |
| Molecular Weight | 665.66 g/mol |
| Exact Mass | 665.26 |
| IUPAC Name | diethyl 4-[2-[4-[(2-hydroxy-3-phenoxypropyl)amino]butoxy]-5-nitrophenyl]-2-methyl-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(C(F)(F)F)=C(C(=O)OCC)C1c1cc([N+](=O)[O-])ccc1OCCCCNCC(O)COc1ccccc1 |
| InChI | InChI=1S/C32H38F3N3O9/c1-4-44-30(40)26-20(3)37-29(32(33,34)35)28(31(41)45-5-2)27(26)24-17-21(38(42)43)13-14-25(24)46-16-10-9-15-36-18-22(39)19-47-23-11-7-6-8-12-23/h6-8,11-14,17,22,27,36-37,39H,4-5,9-10,15-16,18-19H2,1-3H3 |
| InChIKey | MUEMVLQDVJXULM-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 158.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.66 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|