C31H39N3O9 — CID 54365444
dimethyl 4-[2-[5-[(2-hydroxy-3-phenoxypropyl)amino]pentoxy]-5-nitrophenyl]-2,6-dimethyl-3,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 54365444) has the molecular formula C31H39N3O9 and a molecular weight of 597.67 g/mol. Its IUPAC name is dimethyl 4-[2-[5-[(2-hydroxy-3-phenoxypropyl)amino]pentoxy]-5-nitrophenyl]-2,6-dimethyl-3,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | dimethyl 4-[2-[5-[(2-hydroxy-3-phenoxypropyl)amino]pentoxy]-5-nitrophenyl]-2,6-dimethyl-3,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 54365444 |
| Molecular Formula | C31H39N3O9 |
| Molecular Weight | 597.67 g/mol |
| Exact Mass | 597.27 |
| IUPAC Name | dimethyl 4-[2-[5-[(2-hydroxy-3-phenoxypropyl)amino]pentoxy]-5-nitrophenyl]-2,6-dimethyl-3,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)N=C(C)C(C(=O)OC)C1c1cc([N+](=O)[O-])ccc1OCCCCCNCC(O)COc1ccccc1 |
| InChI | InChI=1S/C31H39N3O9/c1-20-27(30(36)40-3)29(28(21(2)33-20)31(37)41-4)25-17-22(34(38)39)13-14-26(25)42-16-10-6-9-15-32-18-23(35)19-43-24-11-7-5-8-12-24/h5,7-8,11-14,17,23,27,29,32,35H,6,9-10,15-16,18-19H2,1-4H3 |
| InChIKey | UPLVLDYHKVRQMM-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 158.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.67 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|