C28H30F3N3O9 — CID 67860375
4-[2-[4-[(2-hydroxy-3-phenoxypropyl)amino]butoxy]-5-nitrophenyl]-2-methyl-6-(trifluoromethyl)-3,4-dihydropyridine-3,5-dicarboxylic acid (PubChem CID 67860375) has the molecular formula C28H30F3N3O9 and a molecular weight of 609.55 g/mol. Its IUPAC name is 4-[2-[4-[(2-hydroxy-3-phenoxypropyl)amino]butoxy]-5-nitrophenyl]-2-methyl-6-(trifluoromethyl)-3,4-dihydropyridine-3,5-dicarboxylic acid.
| Compound Name | 4-[2-[4-[(2-hydroxy-3-phenoxypropyl)amino]butoxy]-5-nitrophenyl]-2-methyl-6-(trifluoromethyl)-3,4-dihydropyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 67860375 |
| Molecular Formula | C28H30F3N3O9 |
| Molecular Weight | 609.55 g/mol |
| Exact Mass | 609.19 |
| IUPAC Name | 4-[2-[4-[(2-hydroxy-3-phenoxypropyl)amino]butoxy]-5-nitrophenyl]-2-methyl-6-(trifluoromethyl)-3,4-dihydropyridine-3,5-dicarboxylic acid |
| SMILES | CC1=NC(C(F)(F)F)=C(C(=O)O)C(c2cc([N+](=O)[O-])ccc2OCCCCNCC(O)COc2ccccc2)C1C(=O)O |
| InChI | InChI=1S/C28H30F3N3O9/c1-16-22(26(36)37)23(24(27(38)39)25(33-16)28(29,30)31)20-13-17(34(40)41)9-10-21(20)42-12-6-5-11-32-14-18(35)15-43-19-7-3-2-4-8-19/h2-4,7-10,13,18,22-23,32,35H,5-6,11-12,14-15H2,1H3,(H,36,37)(H,38,39) |
| InChIKey | MPDPLGZHFNBVPZ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 180.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.55 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|