C19H18BrF3N2O7 — CID 57250203
4-[2-(4-bromobutoxy)-5-nitrophenyl]-2-methyl-6-(trifluoromethyl)-3,4-dihydropyridine-3,5-dicarboxylic acid (PubChem CID 57250203) has the molecular formula C19H18BrF3N2O7 and a molecular weight of 523.26 g/mol. Its IUPAC name is 4-[2-(4-bromobutoxy)-5-nitrophenyl]-2-methyl-6-(trifluoromethyl)-3,4-dihydropyridine-3,5-dicarboxylic acid.
| Compound Name | 4-[2-(4-bromobutoxy)-5-nitrophenyl]-2-methyl-6-(trifluoromethyl)-3,4-dihydropyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 57250203 |
| Molecular Formula | C19H18BrF3N2O7 |
| Molecular Weight | 523.26 g/mol |
| Exact Mass | 522.02 |
| IUPAC Name | 4-[2-(4-bromobutoxy)-5-nitrophenyl]-2-methyl-6-(trifluoromethyl)-3,4-dihydropyridine-3,5-dicarboxylic acid |
| SMILES | CC1=NC(C(F)(F)F)=C(C(=O)O)C(c2cc([N+](=O)[O-])ccc2OCCCCBr)C1C(=O)O |
| InChI | InChI=1S/C19H18BrF3N2O7/c1-9-13(17(26)27)14(15(18(28)29)16(24-9)19(21,22)23)11-8-10(25(30)31)4-5-12(11)32-7-3-2-6-20/h4-5,8,13-14H,2-3,6-7H2,1H3,(H,26,27)(H,28,29) |
| InChIKey | JXVDWPJVPFGPBJ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 139.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.26 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|