C23H30N2O8 — CID 70407137
4-[2-(4-butoxybutoxy)-5-nitrophenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylic acid (PubChem CID 70407137) has the molecular formula C23H30N2O8 and a molecular weight of 462.50 g/mol. Its IUPAC name is 4-[2-(4-butoxybutoxy)-5-nitrophenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylic acid.
| Compound Name | 4-[2-(4-butoxybutoxy)-5-nitrophenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 70407137 |
| Molecular Formula | C23H30N2O8 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | 4-[2-(4-butoxybutoxy)-5-nitrophenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylic acid |
| SMILES | CCCCOCCCCOc1ccc([N+](=O)[O-])cc1C1C(C(=O)O)=C(C)NC(C)=C1C(=O)O |
| InChI | InChI=1S/C23H30N2O8/c1-4-5-10-32-11-6-7-12-33-18-9-8-16(25(30)31)13-17(18)21-19(22(26)27)14(2)24-15(3)20(21)23(28)29/h8-9,13,21,24H,4-7,10-12H2,1-3H3,(H,26,27)(H,28,29) |
| InChIKey | KYFBINRBKDUUQF-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 148.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|