About hexyl 2-hexoxy-5-nitrobenzoate
hexyl 2-hexoxy-5-nitrobenzoate (PubChem CID 139925523) has the molecular formula C19H29NO5
and a molecular weight of 351.44 g/mol. Its IUPAC name is hexyl 2-hexoxy-5-nitrobenzoate.
Molecular Properties
| Compound Name | hexyl 2-hexoxy-5-nitrobenzoate |
| PubChem CID | 139925523 |
| Molecular Formula | C19H29NO5 |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | hexyl 2-hexoxy-5-nitrobenzoate |
| SMILES | CCCCCCOC(=O)c1cc([N+](=O)[O-])ccc1OCCCCCC |
| InChI | InChI=1S/C19H29NO5/c1-3-5-7-9-13-24-18-12-11-16(20(22)23)15-17(18)19(21)25-14-10-8-6-4-2/h11-12,15H,3-10,13-14H2,1-2H3 |
| InChIKey | SBZVFFCAFZKKIA-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze hexyl 2-hexoxy-5-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexyl 2-hexoxy-5-nitrobenzoate?
The IUPAC name of hexyl 2-hexoxy-5-nitrobenzoate (CID 139925523) is hexyl 2-hexoxy-5-nitrobenzoate.
What is the SMILES notation for hexyl 2-hexoxy-5-nitrobenzoate?
The canonical SMILES for hexyl 2-hexoxy-5-nitrobenzoate is CCCCCCOC(=O)c1cc([N+](=O)[O-])ccc1OCCCCCC.
What is the InChIKey of hexyl 2-hexoxy-5-nitrobenzoate?
The InChIKey is SBZVFFCAFZKKIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29NO5/c1-3-5-7-9-13-24-18-12-11-16(20(22)23)15-17(18)19(21)25-14-10-8-6-4-2/h11-12,15H,3-10,13-14H2,1-2H3.
What are the key properties of hexyl 2-hexoxy-5-nitrobenzoate?
hexyl 2-hexoxy-5-nitrobenzoate has a molecular weight of 351.44 g/mol, XLogP of 5.29, 13 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for hexyl 2-hexoxy-5-nitrobenzoate is sourced from PubChem (CID 139925523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).