C57H84O9 — CID 101016396
triheptyl 3,7,10-tripentoxytriphenylene-2,6,11-tricarboxylate (PubChem CID 101016396) has the molecular formula C57H84O9 and a molecular weight of 913.29 g/mol. Its IUPAC name is triheptyl 3,7,10-tripentoxytriphenylene-2,6,11-tricarboxylate.
| Compound Name | triheptyl 3,7,10-tripentoxytriphenylene-2,6,11-tricarboxylate |
|---|---|
| PubChem CID | 101016396 |
| Molecular Formula | C57H84O9 |
| Molecular Weight | 913.29 g/mol |
| Exact Mass | 912.61 |
| IUPAC Name | triheptyl 3,7,10-tripentoxytriphenylene-2,6,11-tricarboxylate |
| SMILES | CCCCCCCOC(=O)c1cc2c(cc1OCCCCC)c1cc(OCCCCC)c(C(=O)OCCCCCCC)cc1c1cc(C(=O)OCCCCCCC)c(OCCCCC)cc21 |
| InChI | InChI=1S/C57H84O9/c1-7-13-19-22-28-34-64-55(58)49-37-43-44-38-50(56(59)65-35-29-23-20-14-8-2)53(62-32-26-17-11-5)41-47(44)48-42-54(63-33-27-18-12-6)51(57(60)66-36-30-24-21-15-9-3)39-45(48)46(43)40-52(49)61-31-25-16-10-4/h37-42H,7-36H2,1-6H3 |
| InChIKey | GUQHDDNRUANKJN-UHFFFAOYSA-N |
| XLogP | 16.23 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 913.29 |
| LogP ≤ 5 | 16.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|